About (1-benzylpyrazol-4-yl)methyl 5-methoxy-1,3-dimethylpyrazole-4-carboxylate
(1-benzylpyrazol-4-yl)methyl 5-methoxy-1,3-dimethylpyrazole-4-carboxylate (PubChem CID 75420545) has the molecular formula C18H20N4O3
and a molecular weight of 340.38 g/mol. Its IUPAC name is (1-benzylpyrazol-4-yl)methyl 5-methoxy-1,3-dimethylpyrazole-4-carboxylate.
Molecular Properties
| Compound Name | (1-benzylpyrazol-4-yl)methyl 5-methoxy-1,3-dimethylpyrazole-4-carboxylate |
| PubChem CID | 75420545 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (1-benzylpyrazol-4-yl)methyl 5-methoxy-1,3-dimethylpyrazole-4-carboxylate |
| SMILES | COc1c(C(=O)OCc2cnn(Cc3ccccc3)c2)c(C)nn1C |
| InChI | InChI=1S/C18H20N4O3/c1-13-16(17(24-3)21(2)20-13)18(23)25-12-15-9-19-22(11-15)10-14-7-5-4-6-8-14/h4-9,11H,10,12H2,1-3H3 |
| InChIKey | BSINMQODLZAYKA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (1-benzylpyrazol-4-yl)methyl 5-methoxy-1,3-dimethylpyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzylpyrazol-4-yl)methyl 5-methoxy-1,3-dimethylpyrazole-4-carboxylate?
The IUPAC name of (1-benzylpyrazol-4-yl)methyl 5-methoxy-1,3-dimethylpyrazole-4-carboxylate (CID 75420545) is (1-benzylpyrazol-4-yl)methyl 5-methoxy-1,3-dimethylpyrazole-4-carboxylate.
What is the SMILES notation for (1-benzylpyrazol-4-yl)methyl 5-methoxy-1,3-dimethylpyrazole-4-carboxylate?
The canonical SMILES for (1-benzylpyrazol-4-yl)methyl 5-methoxy-1,3-dimethylpyrazole-4-carboxylate is COc1c(C(=O)OCc2cnn(Cc3ccccc3)c2)c(C)nn1C.
What is the InChIKey of (1-benzylpyrazol-4-yl)methyl 5-methoxy-1,3-dimethylpyrazole-4-carboxylate?
The InChIKey is BSINMQODLZAYKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O3/c1-13-16(17(24-3)21(2)20-13)18(23)25-12-15-9-19-22(11-15)10-14-7-5-4-6-8-14/h4-9,11H,10,12H2,1-3H3.
What are the key properties of (1-benzylpyrazol-4-yl)methyl 5-methoxy-1,3-dimethylpyrazole-4-carboxylate?
(1-benzylpyrazol-4-yl)methyl 5-methoxy-1,3-dimethylpyrazole-4-carboxylate has a molecular weight of 340.38 g/mol, XLogP of 2.34, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzylpyrazol-4-yl)methyl 5-methoxy-1,3-dimethylpyrazole-4-carboxylate is sourced from PubChem (CID 75420545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).