About 2-(1-methylpyrazol-4-yl)ethyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate
2-(1-methylpyrazol-4-yl)ethyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate (PubChem CID 75421137) has the molecular formula C12H15N3O3S
and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-(1-methylpyrazol-4-yl)ethyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | 2-(1-methylpyrazol-4-yl)ethyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate |
| PubChem CID | 75421137 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-(1-methylpyrazol-4-yl)ethyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate |
| SMILES | COCc1nc(C(=O)OCCc2cnn(C)c2)cs1 |
| InChI | InChI=1S/C12H15N3O3S/c1-15-6-9(5-13-15)3-4-18-12(16)10-8-19-11(14-10)7-17-2/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | NJXJBTBJSZVLNZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(1-methylpyrazol-4-yl)ethyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methylpyrazol-4-yl)ethyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate?
The IUPAC name of 2-(1-methylpyrazol-4-yl)ethyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate (CID 75421137) is 2-(1-methylpyrazol-4-yl)ethyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for 2-(1-methylpyrazol-4-yl)ethyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate?
The canonical SMILES for 2-(1-methylpyrazol-4-yl)ethyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate is COCc1nc(C(=O)OCCc2cnn(C)c2)cs1.
What is the InChIKey of 2-(1-methylpyrazol-4-yl)ethyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate?
The InChIKey is NJXJBTBJSZVLNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O3S/c1-15-6-9(5-13-15)3-4-18-12(16)10-8-19-11(14-10)7-17-2/h5-6,8H,3-4,7H2,1-2H3.
What are the key properties of 2-(1-methylpyrazol-4-yl)ethyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate?
2-(1-methylpyrazol-4-yl)ethyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate has a molecular weight of 281.34 g/mol, XLogP of 1.42, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methylpyrazol-4-yl)ethyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 75421137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).