C17H29IN6S — CID 75421191
3-ethyl-1-methyl-1-[(1-methylpyrazol-4-yl)methyl]-2-[4-(4-methyl-1,3-thiazol-2-yl)butyl]guanidine;hydroiodide (PubChem CID 75421191) has the molecular formula C17H29IN6S and a molecular weight of 476.43 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-[(1-methylpyrazol-4-yl)methyl]-2-[4-(4-methyl-1,3-thiazol-2-yl)butyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-1-[(1-methylpyrazol-4-yl)methyl]-2-[4-(4-methyl-1,3-thiazol-2-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 75421191 |
| Molecular Formula | C17H29IN6S |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 3-ethyl-1-methyl-1-[(1-methylpyrazol-4-yl)methyl]-2-[4-(4-methyl-1,3-thiazol-2-yl)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCCc1nc(C)cs1)N(C)Cc1cnn(C)c1.I |
| InChI | InChI=1S/C17H28N6S.HI/c1-5-18-17(22(3)11-15-10-20-23(4)12-15)19-9-7-6-8-16-21-14(2)13-24-16;/h10,12-13H,5-9,11H2,1-4H3,(H,18,19);1H |
| InChIKey | CIZHJORRSCHYTM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|