About 5-piperidin-4-yl-1,2-dihydropyrazol-3-one;dihydrochloride
5-piperidin-4-yl-1,2-dihydropyrazol-3-one;dihydrochloride (PubChem CID 75421250) has the molecular formula C8H15Cl2N3O
and a molecular weight of 240.13 g/mol. Its IUPAC name is 5-piperidin-4-yl-1,2-dihydropyrazol-3-one;dihydrochloride.
Molecular Properties
| Compound Name | 5-piperidin-4-yl-1,2-dihydropyrazol-3-one;dihydrochloride |
| PubChem CID | 75421250 |
| Molecular Formula | C8H15Cl2N3O |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 5-piperidin-4-yl-1,2-dihydropyrazol-3-one;dihydrochloride |
| SMILES | Cl.Cl.O=c1cc(C2CCNCC2)[nH][nH]1 |
| InChI | InChI=1S/C8H13N3O.2ClH/c12-8-5-7(10-11-8)6-1-3-9-4-2-6;;/h5-6,9H,1-4H2,(H2,10,11,12);2*1H |
| InChIKey | GWMYUQWFUZKEAF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-piperidin-4-yl-1,2-dihydropyrazol-3-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-piperidin-4-yl-1,2-dihydropyrazol-3-one;dihydrochloride?
The IUPAC name of 5-piperidin-4-yl-1,2-dihydropyrazol-3-one;dihydrochloride (CID 75421250) is 5-piperidin-4-yl-1,2-dihydropyrazol-3-one;dihydrochloride.
What is the SMILES notation for 5-piperidin-4-yl-1,2-dihydropyrazol-3-one;dihydrochloride?
The canonical SMILES for 5-piperidin-4-yl-1,2-dihydropyrazol-3-one;dihydrochloride is Cl.Cl.O=c1cc(C2CCNCC2)[nH][nH]1.
What is the InChIKey of 5-piperidin-4-yl-1,2-dihydropyrazol-3-one;dihydrochloride?
The InChIKey is GWMYUQWFUZKEAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O.2ClH/c12-8-5-7(10-11-8)6-1-3-9-4-2-6;;/h5-6,9H,1-4H2,(H2,10,11,12);2*1H.
What are the key properties of 5-piperidin-4-yl-1,2-dihydropyrazol-3-one;dihydrochloride?
5-piperidin-4-yl-1,2-dihydropyrazol-3-one;dihydrochloride has a molecular weight of 240.13 g/mol, XLogP of 1.01, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-piperidin-4-yl-1,2-dihydropyrazol-3-one;dihydrochloride is sourced from PubChem (CID 75421250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).