About 5-propan-2-yl-N-[1-(trifluoromethyl)cyclohexyl]-1,3-oxazole-4-carboxamide
5-propan-2-yl-N-[1-(trifluoromethyl)cyclohexyl]-1,3-oxazole-4-carboxamide (PubChem CID 75421355) has the molecular formula C14H19F3N2O2
and a molecular weight of 304.31 g/mol. Its IUPAC name is 5-propan-2-yl-N-[1-(trifluoromethyl)cyclohexyl]-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-propan-2-yl-N-[1-(trifluoromethyl)cyclohexyl]-1,3-oxazole-4-carboxamide |
| PubChem CID | 75421355 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 5-propan-2-yl-N-[1-(trifluoromethyl)cyclohexyl]-1,3-oxazole-4-carboxamide |
| SMILES | CC(C)c1ocnc1C(=O)NC1(C(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C14H19F3N2O2/c1-9(2)11-10(18-8-21-11)12(20)19-13(14(15,16)17)6-4-3-5-7-13/h8-9H,3-7H2,1-2H3,(H,19,20) |
| InChIKey | AZIKQWFWGNIEGJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-propan-2-yl-N-[1-(trifluoromethyl)cyclohexyl]-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-N-[1-(trifluoromethyl)cyclohexyl]-1,3-oxazole-4-carboxamide?
The IUPAC name of 5-propan-2-yl-N-[1-(trifluoromethyl)cyclohexyl]-1,3-oxazole-4-carboxamide (CID 75421355) is 5-propan-2-yl-N-[1-(trifluoromethyl)cyclohexyl]-1,3-oxazole-4-carboxamide.
What is the SMILES notation for 5-propan-2-yl-N-[1-(trifluoromethyl)cyclohexyl]-1,3-oxazole-4-carboxamide?
The canonical SMILES for 5-propan-2-yl-N-[1-(trifluoromethyl)cyclohexyl]-1,3-oxazole-4-carboxamide is CC(C)c1ocnc1C(=O)NC1(C(F)(F)F)CCCCC1.
What is the InChIKey of 5-propan-2-yl-N-[1-(trifluoromethyl)cyclohexyl]-1,3-oxazole-4-carboxamide?
The InChIKey is AZIKQWFWGNIEGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F3N2O2/c1-9(2)11-10(18-8-21-11)12(20)19-13(14(15,16)17)6-4-3-5-7-13/h8-9H,3-7H2,1-2H3,(H,19,20).
What are the key properties of 5-propan-2-yl-N-[1-(trifluoromethyl)cyclohexyl]-1,3-oxazole-4-carboxamide?
5-propan-2-yl-N-[1-(trifluoromethyl)cyclohexyl]-1,3-oxazole-4-carboxamide has a molecular weight of 304.31 g/mol, XLogP of 3.79, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-N-[1-(trifluoromethyl)cyclohexyl]-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 75421355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).