C17H24N2O3 — CID 75422050
N-[3-(oxolan-3-ylmethoxy)propyl]-1,3-dihydroisoindole-2-carboxamide (PubChem CID 75422050) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-[3-(oxolan-3-ylmethoxy)propyl]-1,3-dihydroisoindole-2-carboxamide.
| Compound Name | N-[3-(oxolan-3-ylmethoxy)propyl]-1,3-dihydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 75422050 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-[3-(oxolan-3-ylmethoxy)propyl]-1,3-dihydroisoindole-2-carboxamide |
| SMILES | O=C(NCCCOCC1CCOC1)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C17H24N2O3/c20-17(19-10-15-4-1-2-5-16(15)11-19)18-7-3-8-21-12-14-6-9-22-13-14/h1-2,4-5,14H,3,6-13H2,(H,18,20) |
| InChIKey | QOURUDDUDHKIBI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|