C9H6ClNO2 — CID 75422059
3-(3-chlorophenyl)-4H-1,2-oxazol-5-one (PubChem CID 75422059) has the molecular formula C9H6ClNO2 and a molecular weight of 195.61 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-4H-1,2-oxazol-5-one.
| Compound Name | 3-(3-chlorophenyl)-4H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 75422059 |
| Molecular Formula | C9H6ClNO2 |
| Molecular Weight | 195.61 g/mol |
| Exact Mass | 195.01 |
| IUPAC Name | 3-(3-chlorophenyl)-4H-1,2-oxazol-5-one |
| SMILES | O=C1CC(c2cccc(Cl)c2)=NO1 |
| InChI | InChI=1S/C9H6ClNO2/c10-7-3-1-2-6(4-7)8-5-9(12)13-11-8/h1-4H,5H2 |
| InChIKey | BVAIGBCPSXKAMZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.61 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|