C16H12FN3O4 — CID 75423991
1-[(2-fluoro-4-nitrophenyl)methyl]-6-oxo-N-prop-2-ynylpyridine-3-carboxamide (PubChem CID 75423991) has the molecular formula C16H12FN3O4 and a molecular weight of 329.29 g/mol. Its IUPAC name is 1-[(2-fluoro-4-nitrophenyl)methyl]-6-oxo-N-prop-2-ynylpyridine-3-carboxamide.
| Compound Name | 1-[(2-fluoro-4-nitrophenyl)methyl]-6-oxo-N-prop-2-ynylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 75423991 |
| Molecular Formula | C16H12FN3O4 |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 1-[(2-fluoro-4-nitrophenyl)methyl]-6-oxo-N-prop-2-ynylpyridine-3-carboxamide |
| SMILES | C#CCNC(=O)c1ccc(=O)n(Cc2ccc([N+](=O)[O-])cc2F)c1 |
| InChI | InChI=1S/C16H12FN3O4/c1-2-7-18-16(22)12-4-6-15(21)19(10-12)9-11-3-5-13(20(23)24)8-14(11)17/h1,3-6,8,10H,7,9H2,(H,18,22) |
| InChIKey | UTMWWJNZPPOJKS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 94.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|