About 6-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]pyridine-3-carbonitrile
6-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]pyridine-3-carbonitrile (PubChem CID 75424169) has the molecular formula C12H13N3O
and a molecular weight of 215.26 g/mol. Its IUPAC name is 6-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]pyridine-3-carbonitrile |
| PubChem CID | 75424169 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 6-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(N[C@@H]2C=C[C@H](CO)C2)nc1 |
| InChI | InChI=1S/C12H13N3O/c13-6-10-2-4-12(14-7-10)15-11-3-1-9(5-11)8-16/h1-4,7,9,11,16H,5,8H2,(H,14,15)/t9-,11+/m0/s1 |
| InChIKey | UJYXYSDOCPTMQQ-GXSJLCMTSA-N |
| XLogP | 1.30 |
| TPSA | 68.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]pyridine-3-carbonitrile?
The IUPAC name of 6-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]pyridine-3-carbonitrile (CID 75424169) is 6-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]pyridine-3-carbonitrile.
What is the SMILES notation for 6-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]pyridine-3-carbonitrile?
The canonical SMILES for 6-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]pyridine-3-carbonitrile is N#Cc1ccc(N[C@@H]2C=C[C@H](CO)C2)nc1.
What is the InChIKey of 6-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]pyridine-3-carbonitrile?
The InChIKey is UJYXYSDOCPTMQQ-GXSJLCMTSA-N. The full InChI is InChI=1S/C12H13N3O/c13-6-10-2-4-12(14-7-10)15-11-3-1-9(5-11)8-16/h1-4,7,9,11,16H,5,8H2,(H,14,15)/t9-,11+/m0/s1.
What are the key properties of 6-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]pyridine-3-carbonitrile?
6-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]pyridine-3-carbonitrile has a molecular weight of 215.26 g/mol, XLogP of 1.30, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]pyridine-3-carbonitrile is sourced from PubChem (CID 75424169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).