About N,1-dimethylpyrazol-3-amine;hydrochloride
N,1-dimethylpyrazol-3-amine;hydrochloride (PubChem CID 75424425) has the molecular formula C5H10ClN3
and a molecular weight of 147.61 g/mol. Its IUPAC name is N,1-dimethylpyrazol-3-amine;hydrochloride.
Molecular Properties
| Compound Name | N,1-dimethylpyrazol-3-amine;hydrochloride |
| PubChem CID | 75424425 |
| Molecular Formula | C5H10ClN3 |
| Molecular Weight | 147.61 g/mol |
| Exact Mass | 147.06 |
| IUPAC Name | N,1-dimethylpyrazol-3-amine;hydrochloride |
| SMILES | CNc1ccn(C)n1.Cl |
| InChI | InChI=1S/C5H9N3.ClH/c1-6-5-3-4-8(2)7-5;/h3-4H,1-2H3,(H,6,7);1H |
| InChIKey | FIBLQNXKXLMOOP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.61 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,1-dimethylpyrazol-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,1-dimethylpyrazol-3-amine;hydrochloride?
The IUPAC name of N,1-dimethylpyrazol-3-amine;hydrochloride (CID 75424425) is N,1-dimethylpyrazol-3-amine;hydrochloride.
What is the SMILES notation for N,1-dimethylpyrazol-3-amine;hydrochloride?
The canonical SMILES for N,1-dimethylpyrazol-3-amine;hydrochloride is CNc1ccn(C)n1.Cl.
What is the InChIKey of N,1-dimethylpyrazol-3-amine;hydrochloride?
The InChIKey is FIBLQNXKXLMOOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3.ClH/c1-6-5-3-4-8(2)7-5;/h3-4H,1-2H3,(H,6,7);1H.
What are the key properties of N,1-dimethylpyrazol-3-amine;hydrochloride?
N,1-dimethylpyrazol-3-amine;hydrochloride has a molecular weight of 147.61 g/mol, XLogP of 0.88, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,1-dimethylpyrazol-3-amine;hydrochloride is sourced from PubChem (CID 75424425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).