C15H17F3N4O4S — CID 75424650
2-methyl-4-nitro-N-[2,2,2-trifluoro-1-(1,3,5-trimethylpyrazol-4-yl)ethyl]benzenesulfonamide (PubChem CID 75424650) has the molecular formula C15H17F3N4O4S and a molecular weight of 406.39 g/mol. Its IUPAC name is 2-methyl-4-nitro-N-[2,2,2-trifluoro-1-(1,3,5-trimethylpyrazol-4-yl)ethyl]benzenesulfonamide.
| Compound Name | 2-methyl-4-nitro-N-[2,2,2-trifluoro-1-(1,3,5-trimethylpyrazol-4-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 75424650 |
| Molecular Formula | C15H17F3N4O4S |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 2-methyl-4-nitro-N-[2,2,2-trifluoro-1-(1,3,5-trimethylpyrazol-4-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1S(=O)(=O)NC(c1c(C)nn(C)c1C)C(F)(F)F |
| InChI | InChI=1S/C15H17F3N4O4S/c1-8-7-11(22(23)24)5-6-12(8)27(25,26)20-14(15(16,17)18)13-9(2)19-21(4)10(13)3/h5-7,14,20H,1-4H3 |
| InChIKey | RAKCUBOVBDCEGH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|