C10H13ClN6 — CID 75424782
5-chloro-N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)propyl]pyrimidin-2-amine (PubChem CID 75424782) has the molecular formula C10H13ClN6 and a molecular weight of 252.71 g/mol. Its IUPAC name is 5-chloro-N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)propyl]pyrimidin-2-amine.
| Compound Name | 5-chloro-N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)propyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 75424782 |
| Molecular Formula | C10H13ClN6 |
| Molecular Weight | 252.71 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 5-chloro-N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)propyl]pyrimidin-2-amine |
| SMILES | Cc1nc(CCCNc2ncc(Cl)cn2)n[nH]1 |
| InChI | InChI=1S/C10H13ClN6/c1-7-15-9(17-16-7)3-2-4-12-10-13-5-8(11)6-14-10/h5-6H,2-4H2,1H3,(H,12,13,14)(H,15,16,17) |
| InChIKey | NEYIVHQUODPKRH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.71 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|