C17H17N3O5 — CID 7542484
(3-cyano-4-imino-2-oxopentyl) 3-(3-oxo-1,4-benzoxazin-4-yl)propanoate (PubChem CID 7542484) has the molecular formula C17H17N3O5 and a molecular weight of 343.34 g/mol. Its IUPAC name is (3-cyano-4-imino-2-oxopentyl) 3-(3-oxo-1,4-benzoxazin-4-yl)propanoate.
| Compound Name | (3-cyano-4-imino-2-oxopentyl) 3-(3-oxo-1,4-benzoxazin-4-yl)propanoate |
|---|---|
| PubChem CID | 7542484 |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | (3-cyano-4-imino-2-oxopentyl) 3-(3-oxo-1,4-benzoxazin-4-yl)propanoate |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)COC(=O)CCN1C(=O)COc2ccccc21 |
| InChI | InChI=1S/C17H17N3O5/c1-11(19)12(8-18)14(21)9-25-17(23)6-7-20-13-4-2-3-5-15(13)24-10-16(20)22/h2-5,12,19H,6-7,9-10H2,1H3/b19-11+ |
| InChIKey | RFSRATJFANBGIQ-YBFXNURJSA-N |
| XLogP | 1.09 |
| TPSA | 120.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|