C16H18N4O2S — CID 75424901
3-[(5-oxopyrrolidin-2-yl)methyl]-1-pyridin-2-yl-1-(thiophen-2-ylmethyl)urea (PubChem CID 75424901) has the molecular formula C16H18N4O2S and a molecular weight of 330.41 g/mol. Its IUPAC name is 3-[(5-oxopyrrolidin-2-yl)methyl]-1-pyridin-2-yl-1-(thiophen-2-ylmethyl)urea.
| Compound Name | 3-[(5-oxopyrrolidin-2-yl)methyl]-1-pyridin-2-yl-1-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 75424901 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 3-[(5-oxopyrrolidin-2-yl)methyl]-1-pyridin-2-yl-1-(thiophen-2-ylmethyl)urea |
| SMILES | O=C1CCC(CNC(=O)N(Cc2cccs2)c2ccccn2)N1 |
| InChI | InChI=1S/C16H18N4O2S/c21-15-7-6-12(19-15)10-18-16(22)20(11-13-4-3-9-23-13)14-5-1-2-8-17-14/h1-5,8-9,12H,6-7,10-11H2,(H,18,22)(H,19,21) |
| InChIKey | BWPNTLMEOXNELS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |