About 2-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl-propan-2-ylamino]ethanol
2-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl-propan-2-ylamino]ethanol (PubChem CID 75425341) has the molecular formula C11H20N2O2S
and a molecular weight of 244.36 g/mol. Its IUPAC name is 2-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl-propan-2-ylamino]ethanol.
Molecular Properties
| Compound Name | 2-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl-propan-2-ylamino]ethanol |
| PubChem CID | 75425341 |
| Molecular Formula | C11H20N2O2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 2-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl-propan-2-ylamino]ethanol |
| SMILES | COCc1nc(CN(CCO)C(C)C)cs1 |
| InChI | InChI=1S/C11H20N2O2S/c1-9(2)13(4-5-14)6-10-8-16-11(12-10)7-15-3/h8-9,14H,4-7H2,1-3H3 |
| InChIKey | KYCOSAJXYJXMSZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl-propan-2-ylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl-propan-2-ylamino]ethanol?
The IUPAC name of 2-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl-propan-2-ylamino]ethanol (CID 75425341) is 2-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl-propan-2-ylamino]ethanol.
What is the SMILES notation for 2-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl-propan-2-ylamino]ethanol?
The canonical SMILES for 2-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl-propan-2-ylamino]ethanol is COCc1nc(CN(CCO)C(C)C)cs1.
What is the InChIKey of 2-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl-propan-2-ylamino]ethanol?
The InChIKey is KYCOSAJXYJXMSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O2S/c1-9(2)13(4-5-14)6-10-8-16-11(12-10)7-15-3/h8-9,14H,4-7H2,1-3H3.
What are the key properties of 2-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl-propan-2-ylamino]ethanol?
2-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl-propan-2-ylamino]ethanol has a molecular weight of 244.36 g/mol, XLogP of 1.49, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl-propan-2-ylamino]ethanol is sourced from PubChem (CID 75425341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).