C15H20N6O2 — CID 75425430
1-cyclopropyl-3-[(1-cyclopropyltetrazol-5-yl)methyl]-1-[1-(furan-2-yl)ethyl]urea (PubChem CID 75425430) has the molecular formula C15H20N6O2 and a molecular weight of 316.37 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(1-cyclopropyltetrazol-5-yl)methyl]-1-[1-(furan-2-yl)ethyl]urea.
| Compound Name | 1-cyclopropyl-3-[(1-cyclopropyltetrazol-5-yl)methyl]-1-[1-(furan-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 75425430 |
| Molecular Formula | C15H20N6O2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 1-cyclopropyl-3-[(1-cyclopropyltetrazol-5-yl)methyl]-1-[1-(furan-2-yl)ethyl]urea |
| SMILES | CC(c1ccco1)N(C(=O)NCc1nnnn1C1CC1)C1CC1 |
| InChI | InChI=1S/C15H20N6O2/c1-10(13-3-2-8-23-13)20(11-4-5-11)15(22)16-9-14-17-18-19-21(14)12-6-7-12/h2-3,8,10-12H,4-7,9H2,1H3,(H,16,22) |
| InChIKey | UZDJMCYLOHKRTF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |