About methyl 2-[1-[(3,4,5-trifluorophenyl)methylamino]cyclohexyl]acetate
methyl 2-[1-[(3,4,5-trifluorophenyl)methylamino]cyclohexyl]acetate (PubChem CID 75425745) has the molecular formula C16H20F3NO2
and a molecular weight of 315.33 g/mol. Its IUPAC name is methyl 2-[1-[(3,4,5-trifluorophenyl)methylamino]cyclohexyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[1-[(3,4,5-trifluorophenyl)methylamino]cyclohexyl]acetate |
| PubChem CID | 75425745 |
| Molecular Formula | C16H20F3NO2 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | methyl 2-[1-[(3,4,5-trifluorophenyl)methylamino]cyclohexyl]acetate |
| SMILES | COC(=O)CC1(NCc2cc(F)c(F)c(F)c2)CCCCC1 |
| InChI | InChI=1S/C16H20F3NO2/c1-22-14(21)9-16(5-3-2-4-6-16)20-10-11-7-12(17)15(19)13(18)8-11/h7-8,20H,2-6,9-10H2,1H3 |
| InChIKey | UKBCCRCCUKMKAE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[1-[(3,4,5-trifluorophenyl)methylamino]cyclohexyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[1-[(3,4,5-trifluorophenyl)methylamino]cyclohexyl]acetate?
The IUPAC name of methyl 2-[1-[(3,4,5-trifluorophenyl)methylamino]cyclohexyl]acetate (CID 75425745) is methyl 2-[1-[(3,4,5-trifluorophenyl)methylamino]cyclohexyl]acetate.
What is the SMILES notation for methyl 2-[1-[(3,4,5-trifluorophenyl)methylamino]cyclohexyl]acetate?
The canonical SMILES for methyl 2-[1-[(3,4,5-trifluorophenyl)methylamino]cyclohexyl]acetate is COC(=O)CC1(NCc2cc(F)c(F)c(F)c2)CCCCC1.
What is the InChIKey of methyl 2-[1-[(3,4,5-trifluorophenyl)methylamino]cyclohexyl]acetate?
The InChIKey is UKBCCRCCUKMKAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20F3NO2/c1-22-14(21)9-16(5-3-2-4-6-16)20-10-11-7-12(17)15(19)13(18)8-11/h7-8,20H,2-6,9-10H2,1H3.
What are the key properties of methyl 2-[1-[(3,4,5-trifluorophenyl)methylamino]cyclohexyl]acetate?
methyl 2-[1-[(3,4,5-trifluorophenyl)methylamino]cyclohexyl]acetate has a molecular weight of 315.33 g/mol, XLogP of 3.46, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-[(3,4,5-trifluorophenyl)methylamino]cyclohexyl]acetate is sourced from PubChem (CID 75425745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).