About N-[(1,4-dimethylpiperazin-2-yl)methyl]-N'-methyl-3-pentan-3-ylpyrrolidine-1-carboximidamide
N-[(1,4-dimethylpiperazin-2-yl)methyl]-N'-methyl-3-pentan-3-ylpyrrolidine-1-carboximidamide (PubChem CID 75425788) has the molecular formula C18H37N5
and a molecular weight of 323.53 g/mol. Its IUPAC name is N-[(1,4-dimethylpiperazin-2-yl)methyl]-N'-methyl-3-pentan-3-ylpyrrolidine-1-carboximidamide.
Molecular Properties
| Compound Name | N-[(1,4-dimethylpiperazin-2-yl)methyl]-N'-methyl-3-pentan-3-ylpyrrolidine-1-carboximidamide |
| PubChem CID | 75425788 |
| Molecular Formula | C18H37N5 |
| Molecular Weight | 323.53 g/mol |
| Exact Mass | 323.30 |
| IUPAC Name | N-[(1,4-dimethylpiperazin-2-yl)methyl]-N'-methyl-3-pentan-3-ylpyrrolidine-1-carboximidamide |
| SMILES | CCC(CC)C1CCN(/C(=N\C)NCC2CN(C)CCN2C)C1 |
| InChI | InChI=1S/C18H37N5/c1-6-15(7-2)16-8-9-23(13-16)18(19-3)20-12-17-14-21(4)10-11-22(17)5/h15-17H,6-14H2,1-5H3,(H,19,20) |
| InChIKey | YOTNPOKDAMKTKL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.53 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(1,4-dimethylpiperazin-2-yl)methyl]-N'-methyl-3-pentan-3-ylpyrrolidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,4-dimethylpiperazin-2-yl)methyl]-N'-methyl-3-pentan-3-ylpyrrolidine-1-carboximidamide?
The IUPAC name of N-[(1,4-dimethylpiperazin-2-yl)methyl]-N'-methyl-3-pentan-3-ylpyrrolidine-1-carboximidamide (CID 75425788) is N-[(1,4-dimethylpiperazin-2-yl)methyl]-N'-methyl-3-pentan-3-ylpyrrolidine-1-carboximidamide.
What is the SMILES notation for N-[(1,4-dimethylpiperazin-2-yl)methyl]-N'-methyl-3-pentan-3-ylpyrrolidine-1-carboximidamide?
The canonical SMILES for N-[(1,4-dimethylpiperazin-2-yl)methyl]-N'-methyl-3-pentan-3-ylpyrrolidine-1-carboximidamide is CCC(CC)C1CCN(/C(=N\C)NCC2CN(C)CCN2C)C1.
What is the InChIKey of N-[(1,4-dimethylpiperazin-2-yl)methyl]-N'-methyl-3-pentan-3-ylpyrrolidine-1-carboximidamide?
The InChIKey is YOTNPOKDAMKTKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37N5/c1-6-15(7-2)16-8-9-23(13-16)18(19-3)20-12-17-14-21(4)10-11-22(17)5/h15-17H,6-14H2,1-5H3,(H,19,20).
What are the key properties of N-[(1,4-dimethylpiperazin-2-yl)methyl]-N'-methyl-3-pentan-3-ylpyrrolidine-1-carboximidamide?
N-[(1,4-dimethylpiperazin-2-yl)methyl]-N'-methyl-3-pentan-3-ylpyrrolidine-1-carboximidamide has a molecular weight of 323.53 g/mol, XLogP of 1.57, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,4-dimethylpiperazin-2-yl)methyl]-N'-methyl-3-pentan-3-ylpyrrolidine-1-carboximidamide is sourced from PubChem (CID 75425788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).