About methyl 5-[[4-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]thiophene-2-carboxylate
methyl 5-[[4-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]thiophene-2-carboxylate (PubChem CID 75425917) has the molecular formula C15H12N2O4S
and a molecular weight of 316.34 g/mol. Its IUPAC name is methyl 5-[[4-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[[4-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]thiophene-2-carboxylate |
| PubChem CID | 75425917 |
| Molecular Formula | C15H12N2O4S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | methyl 5-[[4-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(COc2ccc(-c3nnco3)cc2)s1 |
| InChI | InChI=1S/C15H12N2O4S/c1-19-15(18)13-7-6-12(22-13)8-20-11-4-2-10(3-5-11)14-17-16-9-21-14/h2-7,9H,8H2,1H3 |
| InChIKey | MIAGOQQMWQTKLK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 5-[[4-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[[4-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]thiophene-2-carboxylate?
The IUPAC name of methyl 5-[[4-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]thiophene-2-carboxylate (CID 75425917) is methyl 5-[[4-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]thiophene-2-carboxylate.
What is the SMILES notation for methyl 5-[[4-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]thiophene-2-carboxylate?
The canonical SMILES for methyl 5-[[4-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]thiophene-2-carboxylate is COC(=O)c1ccc(COc2ccc(-c3nnco3)cc2)s1.
What is the InChIKey of methyl 5-[[4-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]thiophene-2-carboxylate?
The InChIKey is MIAGOQQMWQTKLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O4S/c1-19-15(18)13-7-6-12(22-13)8-20-11-4-2-10(3-5-11)14-17-16-9-21-14/h2-7,9H,8H2,1H3.
What are the key properties of methyl 5-[[4-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]thiophene-2-carboxylate?
methyl 5-[[4-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]thiophene-2-carboxylate has a molecular weight of 316.34 g/mol, XLogP of 3.16, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[[4-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]thiophene-2-carboxylate is sourced from PubChem (CID 75425917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).