C20H27N3O — CID 75426168
2-phenyl-2-[(6-pyrrolidin-1-yl-3-pyridinyl)methylamino]butan-1-ol (PubChem CID 75426168) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is 2-phenyl-2-[(6-pyrrolidin-1-yl-3-pyridinyl)methylamino]butan-1-ol.
| Compound Name | 2-phenyl-2-[(6-pyrrolidin-1-yl-3-pyridinyl)methylamino]butan-1-ol |
|---|---|
| PubChem CID | 75426168 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 2-phenyl-2-[(6-pyrrolidin-1-yl-3-pyridinyl)methylamino]butan-1-ol |
| SMILES | CCC(CO)(NCc1ccc(N2CCCC2)nc1)c1ccccc1 |
| InChI | InChI=1S/C20H27N3O/c1-2-20(16-24,18-8-4-3-5-9-18)22-15-17-10-11-19(21-14-17)23-12-6-7-13-23/h3-5,8-11,14,22,24H,2,6-7,12-13,15-16H2,1H3 |
| InChIKey | KJRWJLWADLDAMF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |