C17H22FN3O2 — CID 75426477
N-[(4-cyano-2-fluorophenyl)methyl]-3-(2-methylpropoxy)pyrrolidine-1-carboxamide (PubChem CID 75426477) has the molecular formula C17H22FN3O2 and a molecular weight of 319.38 g/mol. Its IUPAC name is N-[(4-cyano-2-fluorophenyl)methyl]-3-(2-methylpropoxy)pyrrolidine-1-carboxamide.
| Compound Name | N-[(4-cyano-2-fluorophenyl)methyl]-3-(2-methylpropoxy)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 75426477 |
| Molecular Formula | C17H22FN3O2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | N-[(4-cyano-2-fluorophenyl)methyl]-3-(2-methylpropoxy)pyrrolidine-1-carboxamide |
| SMILES | CC(C)COC1CCN(C(=O)NCc2ccc(C#N)cc2F)C1 |
| InChI | InChI=1S/C17H22FN3O2/c1-12(2)11-23-15-5-6-21(10-15)17(22)20-9-14-4-3-13(8-19)7-16(14)18/h3-4,7,12,15H,5-6,9-11H2,1-2H3,(H,20,22) |
| InChIKey | VOWYTFRMKFCLFU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |