C17H27N3O5 — CID 75427428
ethyl 3-[4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoylamino]cyclopentane-1-carboxylate (PubChem CID 75427428) has the molecular formula C17H27N3O5 and a molecular weight of 353.42 g/mol. Its IUPAC name is ethyl 3-[4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoylamino]cyclopentane-1-carboxylate.
| Compound Name | ethyl 3-[4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoylamino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 75427428 |
| Molecular Formula | C17H27N3O5 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | ethyl 3-[4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoylamino]cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(NC(=O)CCCN2C(=O)NC(C)(C)C2=O)C1 |
| InChI | InChI=1S/C17H27N3O5/c1-4-25-14(22)11-7-8-12(10-11)18-13(21)6-5-9-20-15(23)17(2,3)19-16(20)24/h11-12H,4-10H2,1-3H3,(H,18,21)(H,19,24) |
| InChIKey | MUMFLLBPHGHXDS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|