C16H22N2O2 — CID 75427648
methyl N-[4-[(dicyclopropylmethylamino)methyl]phenyl]carbamate (PubChem CID 75427648) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is methyl N-[4-[(dicyclopropylmethylamino)methyl]phenyl]carbamate.
| Compound Name | methyl N-[4-[(dicyclopropylmethylamino)methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 75427648 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | methyl N-[4-[(dicyclopropylmethylamino)methyl]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(CNC(C2CC2)C2CC2)cc1 |
| InChI | InChI=1S/C16H22N2O2/c1-20-16(19)18-14-8-2-11(3-9-14)10-17-15(12-4-5-12)13-6-7-13/h2-3,8-9,12-13,15,17H,4-7,10H2,1H3,(H,18,19) |
| InChIKey | OKSDTESQZRTHRI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |