C15H24N2O2S2 — CID 75427836
N-[3-(1,2,4,5-tetrahydro-3-benzothiepin-5-ylamino)propyl]ethanesulfonamide (PubChem CID 75427836) has the molecular formula C15H24N2O2S2 and a molecular weight of 328.50 g/mol. Its IUPAC name is N-[3-(1,2,4,5-tetrahydro-3-benzothiepin-5-ylamino)propyl]ethanesulfonamide.
| Compound Name | N-[3-(1,2,4,5-tetrahydro-3-benzothiepin-5-ylamino)propyl]ethanesulfonamide |
|---|---|
| PubChem CID | 75427836 |
| Molecular Formula | C15H24N2O2S2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | N-[3-(1,2,4,5-tetrahydro-3-benzothiepin-5-ylamino)propyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCCNC1CSCCc2ccccc21 |
| InChI | InChI=1S/C15H24N2O2S2/c1-2-21(18,19)17-10-5-9-16-15-12-20-11-8-13-6-3-4-7-14(13)15/h3-4,6-7,15-17H,2,5,8-12H2,1H3 |
| InChIKey | GZWRLFFVBNQPHJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|