C18H23N5 — CID 75427882
N-[1-(4-imidazol-1-ylphenyl)ethyl]-3-(1-methylpyrazol-4-yl)propan-1-amine (PubChem CID 75427882) has the molecular formula C18H23N5 and a molecular weight of 309.42 g/mol. Its IUPAC name is N-[1-(4-imidazol-1-ylphenyl)ethyl]-3-(1-methylpyrazol-4-yl)propan-1-amine.
| Compound Name | N-[1-(4-imidazol-1-ylphenyl)ethyl]-3-(1-methylpyrazol-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 75427882 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | N-[1-(4-imidazol-1-ylphenyl)ethyl]-3-(1-methylpyrazol-4-yl)propan-1-amine |
| SMILES | CC(NCCCc1cnn(C)c1)c1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C18H23N5/c1-15(20-9-3-4-16-12-21-22(2)13-16)17-5-7-18(8-6-17)23-11-10-19-14-23/h5-8,10-15,20H,3-4,9H2,1-2H3 |
| InChIKey | XDCLGXSYDGLPSQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|