C19H30N2O2 — CID 75427981
N-[1-(2,4-dimethoxyphenyl)ethyl]-1-(2-methylprop-2-enyl)piperidin-4-amine (PubChem CID 75427981) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is N-[1-(2,4-dimethoxyphenyl)ethyl]-1-(2-methylprop-2-enyl)piperidin-4-amine.
| Compound Name | N-[1-(2,4-dimethoxyphenyl)ethyl]-1-(2-methylprop-2-enyl)piperidin-4-amine |
|---|---|
| PubChem CID | 75427981 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | N-[1-(2,4-dimethoxyphenyl)ethyl]-1-(2-methylprop-2-enyl)piperidin-4-amine |
| SMILES | C=C(C)CN1CCC(NC(C)c2ccc(OC)cc2OC)CC1 |
| InChI | InChI=1S/C19H30N2O2/c1-14(2)13-21-10-8-16(9-11-21)20-15(3)18-7-6-17(22-4)12-19(18)23-5/h6-7,12,15-16,20H,1,8-11,13H2,2-5H3 |
| InChIKey | BUUGWSYYZCXXRA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|