C13H18N2O3S — CID 75429087
(2S)-3,3-dimethyl-2-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]butanoic acid (PubChem CID 75429087) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-2-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]butanoic acid.
| Compound Name | (2S)-3,3-dimethyl-2-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 75429087 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | (2S)-3,3-dimethyl-2-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]butanoic acid |
| SMILES | Cc1ncc(/C=C/C(=O)N[C@H](C(=O)O)C(C)(C)C)s1 |
| InChI | InChI=1S/C13H18N2O3S/c1-8-14-7-9(19-8)5-6-10(16)15-11(12(17)18)13(2,3)4/h5-7,11H,1-4H3,(H,15,16)(H,17,18)/b6-5+/t11-/m1/s1 |
| InChIKey | BNPCPHKCXIOKEY-MVIFTORASA-N |
| XLogP | 2.08 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|