C19H22N2O3 — CID 75429277
2-(1-ethylcyclobutanecarbonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid (PubChem CID 75429277) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-(1-ethylcyclobutanecarbonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid.
| Compound Name | 2-(1-ethylcyclobutanecarbonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid |
|---|---|
| PubChem CID | 75429277 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 2-(1-ethylcyclobutanecarbonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid |
| SMILES | CCC1(C(=O)N2CCc3[nH]c4ccc(C(=O)O)cc4c3C2)CCC1 |
| InChI | InChI=1S/C19H22N2O3/c1-2-19(7-3-8-19)18(24)21-9-6-16-14(11-21)13-10-12(17(22)23)4-5-15(13)20-16/h4-5,10,20H,2-3,6-9,11H2,1H3,(H,22,23) |
| InChIKey | GQEBJOPLLHORNE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|