C19H28N2O4 — CID 75429899
N-(1-cyclohexyl-3-hydroxypropyl)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 75429899) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is N-(1-cyclohexyl-3-hydroxypropyl)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(1-cyclohexyl-3-hydroxypropyl)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 75429899 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N-(1-cyclohexyl-3-hydroxypropyl)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NC(CCO)C1CCCCC1)C1CC(=O)N(Cc2ccco2)C1 |
| InChI | InChI=1S/C19H28N2O4/c22-9-8-17(14-5-2-1-3-6-14)20-19(24)15-11-18(23)21(12-15)13-16-7-4-10-25-16/h4,7,10,14-15,17,22H,1-3,5-6,8-9,11-13H2,(H,20,24) |
| InChIKey | NZHFGHGNSBLUQD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |