C16H22N6O2 — CID 75430331
1-[4-(3-amino-1H-1,2,4-triazol-5-yl)cyclohexyl]-3-(3-methoxyphenyl)urea (PubChem CID 75430331) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 1-[4-(3-amino-1H-1,2,4-triazol-5-yl)cyclohexyl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[4-(3-amino-1H-1,2,4-triazol-5-yl)cyclohexyl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 75430331 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 1-[4-(3-amino-1H-1,2,4-triazol-5-yl)cyclohexyl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)NC2CCC(c3nc(N)n[nH]3)CC2)c1 |
| InChI | InChI=1S/C16H22N6O2/c1-24-13-4-2-3-12(9-13)19-16(23)18-11-7-5-10(6-8-11)14-20-15(17)22-21-14/h2-4,9-11H,5-8H2,1H3,(H2,18,19,23)(H3,17,20,21,22) |
| InChIKey | REVKBOZUUVTLGP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |