About N-cyclopentyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide
N-cyclopentyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide (PubChem CID 7543059) has the molecular formula C9H13N3O4S
and a molecular weight of 259.29 g/mol. Its IUPAC name is N-cyclopentyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide.
Molecular Properties
| Compound Name | N-cyclopentyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide |
| PubChem CID | 7543059 |
| Molecular Formula | C9H13N3O4S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | N-cyclopentyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide |
| SMILES | O=c1[nH]cc(S(=O)(=O)NC2CCCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C9H13N3O4S/c13-8-7(5-10-9(14)11-8)17(15,16)12-6-3-1-2-4-6/h5-6,12H,1-4H2,(H2,10,11,13,14) |
| InChIKey | XVYQQXPWQYXGOE-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopentyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide?
The IUPAC name of N-cyclopentyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide (CID 7543059) is N-cyclopentyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide.
What is the SMILES notation for N-cyclopentyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide?
The canonical SMILES for N-cyclopentyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide is O=c1[nH]cc(S(=O)(=O)NC2CCCC2)c(=O)[nH]1.
What is the InChIKey of N-cyclopentyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide?
The InChIKey is XVYQQXPWQYXGOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O4S/c13-8-7(5-10-9(14)11-8)17(15,16)12-6-3-1-2-4-6/h5-6,12H,1-4H2,(H2,10,11,13,14).
What are the key properties of N-cyclopentyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide?
N-cyclopentyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide has a molecular weight of 259.29 g/mol, XLogP of -0.72, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide is sourced from PubChem (CID 7543059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).