C21H20N2O4S — CID 75431498
N-(1,2-diphenylethyl)-1-(3-nitrophenyl)methanesulfonamide (PubChem CID 75431498) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is N-(1,2-diphenylethyl)-1-(3-nitrophenyl)methanesulfonamide.
| Compound Name | N-(1,2-diphenylethyl)-1-(3-nitrophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 75431498 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | N-(1,2-diphenylethyl)-1-(3-nitrophenyl)methanesulfonamide |
| SMILES | O=[N+]([O-])c1cccc(CS(=O)(=O)NC(Cc2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C21H20N2O4S/c24-23(25)20-13-7-10-18(14-20)16-28(26,27)22-21(19-11-5-2-6-12-19)15-17-8-3-1-4-9-17/h1-14,21-22H,15-16H2 |
| InChIKey | JEINJKWIPMZIFG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|