C20H28N2O2 — CID 75432041
(1R,2S)-1-N,2-N-di(cyclohex-2-en-1-yl)cyclohex-4-ene-1,2-dicarboxamide (PubChem CID 75432041) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is (1R,2S)-1-N,2-N-di(cyclohex-2-en-1-yl)cyclohex-4-ene-1,2-dicarboxamide.
| Compound Name | (1R,2S)-1-N,2-N-di(cyclohex-2-en-1-yl)cyclohex-4-ene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 75432041 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (1R,2S)-1-N,2-N-di(cyclohex-2-en-1-yl)cyclohex-4-ene-1,2-dicarboxamide |
| SMILES | O=C(NC1C=CCCC1)[C@H]1CC=CC[C@H]1C(=O)NC1C=CCCC1 |
| InChI | InChI=1S/C20H28N2O2/c23-19(21-15-9-3-1-4-10-15)17-13-7-8-14-18(17)20(24)22-16-11-5-2-6-12-16/h3,5,7-9,11,15-18H,1-2,4,6,10,12-14H2,(H,21,23)(H,22,24)/t15?,16?,17-,18+ |
| InChIKey | ZQKJLUCOWAYQNW-OWCVQMPJSA-N |
| XLogP | 3.02 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|