About 4-bromo-3-[[3-(1H-1,2,4-triazol-5-yl)anilino]methyl]phenol
4-bromo-3-[[3-(1H-1,2,4-triazol-5-yl)anilino]methyl]phenol (PubChem CID 75432411) has the molecular formula C15H13BrN4O
and a molecular weight of 345.20 g/mol. Its IUPAC name is 4-bromo-3-[[3-(1H-1,2,4-triazol-5-yl)anilino]methyl]phenol.
Molecular Properties
| Compound Name | 4-bromo-3-[[3-(1H-1,2,4-triazol-5-yl)anilino]methyl]phenol |
| PubChem CID | 75432411 |
| Molecular Formula | C15H13BrN4O |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 4-bromo-3-[[3-(1H-1,2,4-triazol-5-yl)anilino]methyl]phenol |
| SMILES | Oc1ccc(Br)c(CNc2cccc(-c3ncn[nH]3)c2)c1 |
| InChI | InChI=1S/C15H13BrN4O/c16-14-5-4-13(21)7-11(14)8-17-12-3-1-2-10(6-12)15-18-9-19-20-15/h1-7,9,17,21H,8H2,(H,18,19,20) |
| InChIKey | XMUNHDCJXSQDAQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-3-[[3-(1H-1,2,4-triazol-5-yl)anilino]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-[[3-(1H-1,2,4-triazol-5-yl)anilino]methyl]phenol?
The IUPAC name of 4-bromo-3-[[3-(1H-1,2,4-triazol-5-yl)anilino]methyl]phenol (CID 75432411) is 4-bromo-3-[[3-(1H-1,2,4-triazol-5-yl)anilino]methyl]phenol.
What is the SMILES notation for 4-bromo-3-[[3-(1H-1,2,4-triazol-5-yl)anilino]methyl]phenol?
The canonical SMILES for 4-bromo-3-[[3-(1H-1,2,4-triazol-5-yl)anilino]methyl]phenol is Oc1ccc(Br)c(CNc2cccc(-c3ncn[nH]3)c2)c1.
What is the InChIKey of 4-bromo-3-[[3-(1H-1,2,4-triazol-5-yl)anilino]methyl]phenol?
The InChIKey is XMUNHDCJXSQDAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13BrN4O/c16-14-5-4-13(21)7-11(14)8-17-12-3-1-2-10(6-12)15-18-9-19-20-15/h1-7,9,17,21H,8H2,(H,18,19,20).
What are the key properties of 4-bromo-3-[[3-(1H-1,2,4-triazol-5-yl)anilino]methyl]phenol?
4-bromo-3-[[3-(1H-1,2,4-triazol-5-yl)anilino]methyl]phenol has a molecular weight of 345.20 g/mol, XLogP of 3.55, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-[[3-(1H-1,2,4-triazol-5-yl)anilino]methyl]phenol is sourced from PubChem (CID 75432411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).