C17H28N6S — CID 75432598
1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-2-methyl-3-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]guanidine (PubChem CID 75432598) has the molecular formula C17H28N6S and a molecular weight of 348.52 g/mol. Its IUPAC name is 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-2-methyl-3-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]guanidine.
| Compound Name | 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-2-methyl-3-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 75432598 |
| Molecular Formula | C17H28N6S |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-2-methyl-3-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]guanidine |
| SMILES | CCc1nn(C)c(CC)c1CN/C(=N/C)NCCc1nc(C)cs1 |
| InChI | InChI=1S/C17H28N6S/c1-6-14-13(15(7-2)23(5)22-14)10-20-17(18-4)19-9-8-16-21-12(3)11-24-16/h11H,6-10H2,1-5H3,(H2,18,19,20) |
| InChIKey | AFXLYZRKBPVFAN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|