About N-[3-(2-methylpropylsulfanyl)propyl]tetrazolo[1,5-b]pyridazin-6-amine
N-[3-(2-methylpropylsulfanyl)propyl]tetrazolo[1,5-b]pyridazin-6-amine (PubChem CID 75432970) has the molecular formula C11H18N6S
and a molecular weight of 266.37 g/mol. Its IUPAC name is N-[3-(2-methylpropylsulfanyl)propyl]tetrazolo[1,5-b]pyridazin-6-amine.
Molecular Properties
| Compound Name | N-[3-(2-methylpropylsulfanyl)propyl]tetrazolo[1,5-b]pyridazin-6-amine |
| PubChem CID | 75432970 |
| Molecular Formula | C11H18N6S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | N-[3-(2-methylpropylsulfanyl)propyl]tetrazolo[1,5-b]pyridazin-6-amine |
| SMILES | CC(C)CSCCCNc1ccc2nnnn2n1 |
| InChI | InChI=1S/C11H18N6S/c1-9(2)8-18-7-3-6-12-10-4-5-11-13-15-16-17(11)14-10/h4-5,9H,3,6-8H2,1-2H3,(H,12,14) |
| InChIKey | GFNSQCKNMSOKJD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(2-methylpropylsulfanyl)propyl]tetrazolo[1,5-b]pyridazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2-methylpropylsulfanyl)propyl]tetrazolo[1,5-b]pyridazin-6-amine?
The IUPAC name of N-[3-(2-methylpropylsulfanyl)propyl]tetrazolo[1,5-b]pyridazin-6-amine (CID 75432970) is N-[3-(2-methylpropylsulfanyl)propyl]tetrazolo[1,5-b]pyridazin-6-amine.
What is the SMILES notation for N-[3-(2-methylpropylsulfanyl)propyl]tetrazolo[1,5-b]pyridazin-6-amine?
The canonical SMILES for N-[3-(2-methylpropylsulfanyl)propyl]tetrazolo[1,5-b]pyridazin-6-amine is CC(C)CSCCCNc1ccc2nnnn2n1.
What is the InChIKey of N-[3-(2-methylpropylsulfanyl)propyl]tetrazolo[1,5-b]pyridazin-6-amine?
The InChIKey is GFNSQCKNMSOKJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N6S/c1-9(2)8-18-7-3-6-12-10-4-5-11-13-15-16-17(11)14-10/h4-5,9H,3,6-8H2,1-2H3,(H,12,14).
What are the key properties of N-[3-(2-methylpropylsulfanyl)propyl]tetrazolo[1,5-b]pyridazin-6-amine?
N-[3-(2-methylpropylsulfanyl)propyl]tetrazolo[1,5-b]pyridazin-6-amine has a molecular weight of 266.37 g/mol, XLogP of 1.71, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2-methylpropylsulfanyl)propyl]tetrazolo[1,5-b]pyridazin-6-amine is sourced from PubChem (CID 75432970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).