About 5-bromo-N-[(1,1-dioxothian-4-yl)methyl]pyrimidin-2-amine
5-bromo-N-[(1,1-dioxothian-4-yl)methyl]pyrimidin-2-amine (PubChem CID 75432973) has the molecular formula C10H14BrN3O2S
and a molecular weight of 320.21 g/mol. Its IUPAC name is 5-bromo-N-[(1,1-dioxothian-4-yl)methyl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-bromo-N-[(1,1-dioxothian-4-yl)methyl]pyrimidin-2-amine |
| PubChem CID | 75432973 |
| Molecular Formula | C10H14BrN3O2S |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 5-bromo-N-[(1,1-dioxothian-4-yl)methyl]pyrimidin-2-amine |
| SMILES | O=S1(=O)CCC(CNc2ncc(Br)cn2)CC1 |
| InChI | InChI=1S/C10H14BrN3O2S/c11-9-6-13-10(14-7-9)12-5-8-1-3-17(15,16)4-2-8/h6-8H,1-5H2,(H,12,13,14) |
| InChIKey | XBTLNTFZQIRPDE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-N-[(1,1-dioxothian-4-yl)methyl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-[(1,1-dioxothian-4-yl)methyl]pyrimidin-2-amine?
The IUPAC name of 5-bromo-N-[(1,1-dioxothian-4-yl)methyl]pyrimidin-2-amine (CID 75432973) is 5-bromo-N-[(1,1-dioxothian-4-yl)methyl]pyrimidin-2-amine.
What is the SMILES notation for 5-bromo-N-[(1,1-dioxothian-4-yl)methyl]pyrimidin-2-amine?
The canonical SMILES for 5-bromo-N-[(1,1-dioxothian-4-yl)methyl]pyrimidin-2-amine is O=S1(=O)CCC(CNc2ncc(Br)cn2)CC1.
What is the InChIKey of 5-bromo-N-[(1,1-dioxothian-4-yl)methyl]pyrimidin-2-amine?
The InChIKey is XBTLNTFZQIRPDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BrN3O2S/c11-9-6-13-10(14-7-9)12-5-8-1-3-17(15,16)4-2-8/h6-8H,1-5H2,(H,12,13,14).
What are the key properties of 5-bromo-N-[(1,1-dioxothian-4-yl)methyl]pyrimidin-2-amine?
5-bromo-N-[(1,1-dioxothian-4-yl)methyl]pyrimidin-2-amine has a molecular weight of 320.21 g/mol, XLogP of 1.48, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-[(1,1-dioxothian-4-yl)methyl]pyrimidin-2-amine is sourced from PubChem (CID 75432973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).