About 2-[cyclohexyl-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]amino]ethanol
2-[cyclohexyl-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]amino]ethanol (PubChem CID 75433321) has the molecular formula C13H26N2O3S
and a molecular weight of 290.43 g/mol. Its IUPAC name is 2-[cyclohexyl-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[cyclohexyl-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]amino]ethanol |
| PubChem CID | 75433321 |
| Molecular Formula | C13H26N2O3S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-[cyclohexyl-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]amino]ethanol |
| SMILES | O=S1(=O)CCCN1CCN(CCO)C1CCCCC1 |
| InChI | InChI=1S/C13H26N2O3S/c16-11-10-14(13-5-2-1-3-6-13)8-9-15-7-4-12-19(15,17)18/h13,16H,1-12H2 |
| InChIKey | DTUKCBSJPGZHMI-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[cyclohexyl-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyclohexyl-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]amino]ethanol?
The IUPAC name of 2-[cyclohexyl-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]amino]ethanol (CID 75433321) is 2-[cyclohexyl-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]amino]ethanol.
What is the SMILES notation for 2-[cyclohexyl-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]amino]ethanol?
The canonical SMILES for 2-[cyclohexyl-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]amino]ethanol is O=S1(=O)CCCN1CCN(CCO)C1CCCCC1.
What is the InChIKey of 2-[cyclohexyl-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]amino]ethanol?
The InChIKey is DTUKCBSJPGZHMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O3S/c16-11-10-14(13-5-2-1-3-6-13)8-9-15-7-4-12-19(15,17)18/h13,16H,1-12H2.
What are the key properties of 2-[cyclohexyl-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]amino]ethanol?
2-[cyclohexyl-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]amino]ethanol has a molecular weight of 290.43 g/mol, XLogP of 0.65, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclohexyl-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]amino]ethanol is sourced from PubChem (CID 75433321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).