C15H16N6O3 — CID 75433748
N-methyl-2-(5-nitro-1H-indol-3-yl)-N-[2-(1,2,4-triazol-4-yl)ethyl]acetamide (PubChem CID 75433748) has the molecular formula C15H16N6O3 and a molecular weight of 328.33 g/mol. Its IUPAC name is N-methyl-2-(5-nitro-1H-indol-3-yl)-N-[2-(1,2,4-triazol-4-yl)ethyl]acetamide.
| Compound Name | N-methyl-2-(5-nitro-1H-indol-3-yl)-N-[2-(1,2,4-triazol-4-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 75433748 |
| Molecular Formula | C15H16N6O3 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | N-methyl-2-(5-nitro-1H-indol-3-yl)-N-[2-(1,2,4-triazol-4-yl)ethyl]acetamide |
| SMILES | CN(CCn1cnnc1)C(=O)Cc1c[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C15H16N6O3/c1-19(4-5-20-9-17-18-10-20)15(22)6-11-8-16-14-3-2-12(21(23)24)7-13(11)14/h2-3,7-10,16H,4-6H2,1H3 |
| InChIKey | JCHSUTSHRSVQOY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 109.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|