C14H23N3O2 — CID 75433750
methyl 1-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]cyclohexane-1-carboxylate (PubChem CID 75433750) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is methyl 1-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 1-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 75433750 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | methyl 1-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(N(C)Cc2cnn(C)c2)CCCCC1 |
| InChI | InChI=1S/C14H23N3O2/c1-16(10-12-9-15-17(2)11-12)14(13(18)19-3)7-5-4-6-8-14/h9,11H,4-8,10H2,1-3H3 |
| InChIKey | NXWLKDGESZDBIT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |