About 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-cyclobutylpyrimidin-4-one
3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-cyclobutylpyrimidin-4-one (PubChem CID 75434116) has the molecular formula C16H21N3OS
and a molecular weight of 303.43 g/mol. Its IUPAC name is 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-cyclobutylpyrimidin-4-one.
Molecular Properties
| Compound Name | 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-cyclobutylpyrimidin-4-one |
| PubChem CID | 75434116 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-cyclobutylpyrimidin-4-one |
| SMILES | CC(C)(C)c1nc(Cn2cnc(C3CCC3)cc2=O)cs1 |
| InChI | InChI=1S/C16H21N3OS/c1-16(2,3)15-18-12(9-21-15)8-19-10-17-13(7-14(19)20)11-5-4-6-11/h7,9-11H,4-6,8H2,1-3H3 |
| InChIKey | KNLCIIAGVWHKBA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-cyclobutylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-cyclobutylpyrimidin-4-one?
The IUPAC name of 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-cyclobutylpyrimidin-4-one (CID 75434116) is 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-cyclobutylpyrimidin-4-one.
What is the SMILES notation for 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-cyclobutylpyrimidin-4-one?
The canonical SMILES for 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-cyclobutylpyrimidin-4-one is CC(C)(C)c1nc(Cn2cnc(C3CCC3)cc2=O)cs1.
What is the InChIKey of 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-cyclobutylpyrimidin-4-one?
The InChIKey is KNLCIIAGVWHKBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3OS/c1-16(2,3)15-18-12(9-21-15)8-19-10-17-13(7-14(19)20)11-5-4-6-11/h7,9-11H,4-6,8H2,1-3H3.
What are the key properties of 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-cyclobutylpyrimidin-4-one?
3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-cyclobutylpyrimidin-4-one has a molecular weight of 303.43 g/mol, XLogP of 3.31, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-cyclobutylpyrimidin-4-one is sourced from PubChem (CID 75434116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).