About (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate
(6-fluoro-1,3-benzoxazol-2-yl)methyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate (PubChem CID 75434252) has the molecular formula C16H13FN2O4S
and a molecular weight of 348.36 g/mol. Its IUPAC name is (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate |
| PubChem CID | 75434252 |
| Molecular Formula | C16H13FN2O4S |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate |
| SMILES | O=C(OCc1nc2ccc(F)cc2o1)c1cnc(C2CCCO2)s1 |
| InChI | InChI=1S/C16H13FN2O4S/c17-9-3-4-10-12(6-9)23-14(19-10)8-22-16(20)13-7-18-15(24-13)11-2-1-5-21-11/h3-4,6-7,11H,1-2,5,8H2 |
| InChIKey | KPSKURUCFSEVRS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate?
The IUPAC name of (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate (CID 75434252) is (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate.
What is the SMILES notation for (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate?
The canonical SMILES for (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate is O=C(OCc1nc2ccc(F)cc2o1)c1cnc(C2CCCO2)s1.
What is the InChIKey of (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate?
The InChIKey is KPSKURUCFSEVRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13FN2O4S/c17-9-3-4-10-12(6-9)23-14(19-10)8-22-16(20)13-7-18-15(24-13)11-2-1-5-21-11/h3-4,6-7,11H,1-2,5,8H2.
What are the key properties of (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate?
(6-fluoro-1,3-benzoxazol-2-yl)methyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate has a molecular weight of 348.36 g/mol, XLogP of 3.63, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (6-fluoro-1,3-benzoxazol-2-yl)methyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 75434252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).