C15H19F3N2O — CID 75434556
3-[[cyclobutyl(2,2,2-trifluoroethyl)amino]methyl]-N-methylbenzamide (PubChem CID 75434556) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is 3-[[cyclobutyl(2,2,2-trifluoroethyl)amino]methyl]-N-methylbenzamide.
| Compound Name | 3-[[cyclobutyl(2,2,2-trifluoroethyl)amino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 75434556 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 3-[[cyclobutyl(2,2,2-trifluoroethyl)amino]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(CN(CC(F)(F)F)C2CCC2)c1 |
| InChI | InChI=1S/C15H19F3N2O/c1-19-14(21)12-5-2-4-11(8-12)9-20(10-15(16,17)18)13-6-3-7-13/h2,4-5,8,13H,3,6-7,9-10H2,1H3,(H,19,21) |
| InChIKey | ZZCSVYCNLVQHDR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |