About 3-[(7-aminopyrido[2,3-d]pyrimidin-4-yl)amino]-N-benzyl-N-methylpropanamide
3-[(7-aminopyrido[2,3-d]pyrimidin-4-yl)amino]-N-benzyl-N-methylpropanamide (PubChem CID 75434699) has the molecular formula C18H20N6O
and a molecular weight of 336.40 g/mol. Its IUPAC name is 3-[(7-aminopyrido[2,3-d]pyrimidin-4-yl)amino]-N-benzyl-N-methylpropanamide.
Molecular Properties
| Compound Name | 3-[(7-aminopyrido[2,3-d]pyrimidin-4-yl)amino]-N-benzyl-N-methylpropanamide |
| PubChem CID | 75434699 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 3-[(7-aminopyrido[2,3-d]pyrimidin-4-yl)amino]-N-benzyl-N-methylpropanamide |
| SMILES | CN(Cc1ccccc1)C(=O)CCNc1ncnc2nc(N)ccc12 |
| InChI | InChI=1S/C18H20N6O/c1-24(11-13-5-3-2-4-6-13)16(25)9-10-20-17-14-7-8-15(19)23-18(14)22-12-21-17/h2-8,12H,9-11H2,1H3,(H3,19,20,21,22,23) |
| InChIKey | NSFKTUOXXMUTCU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(7-aminopyrido[2,3-d]pyrimidin-4-yl)amino]-N-benzyl-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(7-aminopyrido[2,3-d]pyrimidin-4-yl)amino]-N-benzyl-N-methylpropanamide?
The IUPAC name of 3-[(7-aminopyrido[2,3-d]pyrimidin-4-yl)amino]-N-benzyl-N-methylpropanamide (CID 75434699) is 3-[(7-aminopyrido[2,3-d]pyrimidin-4-yl)amino]-N-benzyl-N-methylpropanamide.
What is the SMILES notation for 3-[(7-aminopyrido[2,3-d]pyrimidin-4-yl)amino]-N-benzyl-N-methylpropanamide?
The canonical SMILES for 3-[(7-aminopyrido[2,3-d]pyrimidin-4-yl)amino]-N-benzyl-N-methylpropanamide is CN(Cc1ccccc1)C(=O)CCNc1ncnc2nc(N)ccc12.
What is the InChIKey of 3-[(7-aminopyrido[2,3-d]pyrimidin-4-yl)amino]-N-benzyl-N-methylpropanamide?
The InChIKey is NSFKTUOXXMUTCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N6O/c1-24(11-13-5-3-2-4-6-13)16(25)9-10-20-17-14-7-8-15(19)23-18(14)22-12-21-17/h2-8,12H,9-11H2,1H3,(H3,19,20,21,22,23).
What are the key properties of 3-[(7-aminopyrido[2,3-d]pyrimidin-4-yl)amino]-N-benzyl-N-methylpropanamide?
3-[(7-aminopyrido[2,3-d]pyrimidin-4-yl)amino]-N-benzyl-N-methylpropanamide has a molecular weight of 336.40 g/mol, XLogP of 2.07, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(7-aminopyrido[2,3-d]pyrimidin-4-yl)amino]-N-benzyl-N-methylpropanamide is sourced from PubChem (CID 75434699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).