C11H16N4S — CID 75434824
1-tert-butyl-N-(1,3-thiazol-4-ylmethyl)pyrazol-4-amine (PubChem CID 75434824) has the molecular formula C11H16N4S and a molecular weight of 236.34 g/mol. Its IUPAC name is 1-tert-butyl-N-(1,3-thiazol-4-ylmethyl)pyrazol-4-amine.
| Compound Name | 1-tert-butyl-N-(1,3-thiazol-4-ylmethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 75434824 |
| Molecular Formula | C11H16N4S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 1-tert-butyl-N-(1,3-thiazol-4-ylmethyl)pyrazol-4-amine |
| SMILES | CC(C)(C)n1cc(NCc2cscn2)cn1 |
| InChI | InChI=1S/C11H16N4S/c1-11(2,3)15-6-9(5-14-15)12-4-10-7-16-8-13-10/h5-8,12H,4H2,1-3H3 |
| InChIKey | FBENDQWRMLLSEB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |