C15H20ClFN2O3 — CID 75435564
1-[2-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-3-[(2-methyloxolan-2-yl)methyl]urea (PubChem CID 75435564) has the molecular formula C15H20ClFN2O3 and a molecular weight of 330.79 g/mol. Its IUPAC name is 1-[2-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-3-[(2-methyloxolan-2-yl)methyl]urea.
| Compound Name | 1-[2-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-3-[(2-methyloxolan-2-yl)methyl]urea |
|---|---|
| PubChem CID | 75435564 |
| Molecular Formula | C15H20ClFN2O3 |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 1-[2-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-3-[(2-methyloxolan-2-yl)methyl]urea |
| SMILES | CC1(CNC(=O)NCC(O)c2ccc(Cl)c(F)c2)CCCO1 |
| InChI | InChI=1S/C15H20ClFN2O3/c1-15(5-2-6-22-15)9-19-14(21)18-8-13(20)10-3-4-11(16)12(17)7-10/h3-4,7,13,20H,2,5-6,8-9H2,1H3,(H2,18,19,21) |
| InChIKey | JFNIZYZTMOWQJW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |