About 2-(ethylamino)-N-[(2-methylpropan-2-yl)oxy]-1,3-thiazole-5-carboxamide
2-(ethylamino)-N-[(2-methylpropan-2-yl)oxy]-1,3-thiazole-5-carboxamide (PubChem CID 75435847) has the molecular formula C10H17N3O2S
and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-(ethylamino)-N-[(2-methylpropan-2-yl)oxy]-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-(ethylamino)-N-[(2-methylpropan-2-yl)oxy]-1,3-thiazole-5-carboxamide |
| PubChem CID | 75435847 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 2-(ethylamino)-N-[(2-methylpropan-2-yl)oxy]-1,3-thiazole-5-carboxamide |
| SMILES | CCNc1ncc(C(=O)NOC(C)(C)C)s1 |
| InChI | InChI=1S/C10H17N3O2S/c1-5-11-9-12-6-7(16-9)8(14)13-15-10(2,3)4/h6H,5H2,1-4H3,(H,11,12)(H,13,14) |
| InChIKey | XJAPKVXZYCBSHQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(ethylamino)-N-[(2-methylpropan-2-yl)oxy]-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylamino)-N-[(2-methylpropan-2-yl)oxy]-1,3-thiazole-5-carboxamide?
The IUPAC name of 2-(ethylamino)-N-[(2-methylpropan-2-yl)oxy]-1,3-thiazole-5-carboxamide (CID 75435847) is 2-(ethylamino)-N-[(2-methylpropan-2-yl)oxy]-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2-(ethylamino)-N-[(2-methylpropan-2-yl)oxy]-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2-(ethylamino)-N-[(2-methylpropan-2-yl)oxy]-1,3-thiazole-5-carboxamide is CCNc1ncc(C(=O)NOC(C)(C)C)s1.
What is the InChIKey of 2-(ethylamino)-N-[(2-methylpropan-2-yl)oxy]-1,3-thiazole-5-carboxamide?
The InChIKey is XJAPKVXZYCBSHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2S/c1-5-11-9-12-6-7(16-9)8(14)13-15-10(2,3)4/h6H,5H2,1-4H3,(H,11,12)(H,13,14).
What are the key properties of 2-(ethylamino)-N-[(2-methylpropan-2-yl)oxy]-1,3-thiazole-5-carboxamide?
2-(ethylamino)-N-[(2-methylpropan-2-yl)oxy]-1,3-thiazole-5-carboxamide has a molecular weight of 243.33 g/mol, XLogP of 2.03, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylamino)-N-[(2-methylpropan-2-yl)oxy]-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 75435847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).