About 2-[2-[(4,5-dimethylpyrimidin-2-yl)amino]ethoxy]ethanol
2-[2-[(4,5-dimethylpyrimidin-2-yl)amino]ethoxy]ethanol (PubChem CID 75436307) has the molecular formula C10H17N3O2
and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-[2-[(4,5-dimethylpyrimidin-2-yl)amino]ethoxy]ethanol.
Molecular Properties
| Compound Name | 2-[2-[(4,5-dimethylpyrimidin-2-yl)amino]ethoxy]ethanol |
| PubChem CID | 75436307 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 2-[2-[(4,5-dimethylpyrimidin-2-yl)amino]ethoxy]ethanol |
| SMILES | Cc1cnc(NCCOCCO)nc1C |
| InChI | InChI=1S/C10H17N3O2/c1-8-7-12-10(13-9(8)2)11-3-5-15-6-4-14/h7,14H,3-6H2,1-2H3,(H,11,12,13) |
| InChIKey | GRKMSEGHVHAZDD-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(4,5-dimethylpyrimidin-2-yl)amino]ethoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(4,5-dimethylpyrimidin-2-yl)amino]ethoxy]ethanol?
The IUPAC name of 2-[2-[(4,5-dimethylpyrimidin-2-yl)amino]ethoxy]ethanol (CID 75436307) is 2-[2-[(4,5-dimethylpyrimidin-2-yl)amino]ethoxy]ethanol.
What is the SMILES notation for 2-[2-[(4,5-dimethylpyrimidin-2-yl)amino]ethoxy]ethanol?
The canonical SMILES for 2-[2-[(4,5-dimethylpyrimidin-2-yl)amino]ethoxy]ethanol is Cc1cnc(NCCOCCO)nc1C.
What is the InChIKey of 2-[2-[(4,5-dimethylpyrimidin-2-yl)amino]ethoxy]ethanol?
The InChIKey is GRKMSEGHVHAZDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2/c1-8-7-12-10(13-9(8)2)11-3-5-15-6-4-14/h7,14H,3-6H2,1-2H3,(H,11,12,13).
What are the key properties of 2-[2-[(4,5-dimethylpyrimidin-2-yl)amino]ethoxy]ethanol?
2-[2-[(4,5-dimethylpyrimidin-2-yl)amino]ethoxy]ethanol has a molecular weight of 211.26 g/mol, XLogP of 0.51, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(4,5-dimethylpyrimidin-2-yl)amino]ethoxy]ethanol is sourced from PubChem (CID 75436307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).