About N-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]-2,2-difluoro-N-methylethanamine
N-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]-2,2-difluoro-N-methylethanamine (PubChem CID 75436468) has the molecular formula C12H20F2N2O
and a molecular weight of 246.30 g/mol. Its IUPAC name is N-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]-2,2-difluoro-N-methylethanamine.
Molecular Properties
| Compound Name | N-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]-2,2-difluoro-N-methylethanamine |
| PubChem CID | 75436468 |
| Molecular Formula | C12H20F2N2O |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | N-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]-2,2-difluoro-N-methylethanamine |
| SMILES | CC(c1ncc(C(C)(C)C)o1)N(C)CC(F)F |
| InChI | InChI=1S/C12H20F2N2O/c1-8(16(5)7-10(13)14)11-15-6-9(17-11)12(2,3)4/h6,8,10H,7H2,1-5H3 |
| InChIKey | KPHUCSOPSUJSLS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]-2,2-difluoro-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]-2,2-difluoro-N-methylethanamine?
The IUPAC name of N-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]-2,2-difluoro-N-methylethanamine (CID 75436468) is N-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]-2,2-difluoro-N-methylethanamine.
What is the SMILES notation for N-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]-2,2-difluoro-N-methylethanamine?
The canonical SMILES for N-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]-2,2-difluoro-N-methylethanamine is CC(c1ncc(C(C)(C)C)o1)N(C)CC(F)F.
What is the InChIKey of N-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]-2,2-difluoro-N-methylethanamine?
The InChIKey is KPHUCSOPSUJSLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F2N2O/c1-8(16(5)7-10(13)14)11-15-6-9(17-11)12(2,3)4/h6,8,10H,7H2,1-5H3.
What are the key properties of N-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]-2,2-difluoro-N-methylethanamine?
N-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]-2,2-difluoro-N-methylethanamine has a molecular weight of 246.30 g/mol, XLogP of 3.23, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]-2,2-difluoro-N-methylethanamine is sourced from PubChem (CID 75436468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).