C16H22N4O2S — CID 75437346
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]urea (PubChem CID 75437346) has the molecular formula C16H22N4O2S and a molecular weight of 334.45 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]urea.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 75437346 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]urea |
| SMILES | Cc1nc(CNC(=O)NCCc2nc3c(s2)CCCC3)oc1C |
| InChI | InChI=1S/C16H22N4O2S/c1-10-11(2)22-14(19-10)9-18-16(21)17-8-7-15-20-12-5-3-4-6-13(12)23-15/h3-9H2,1-2H3,(H2,17,18,21) |
| InChIKey | BVJRHCSXRLSRDV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |